3,4,5,6-Tetrahydro-2H-[1,2']bipyridinyl-3-carboxylic acid
3,4,5,6-Tetrahydro-2H-[1,2']bipyridinyl-3-carboxylic acid
CAS: 876718-04-6
Molecular Formula: C11H14N2O2
3,4,5,6-Tetrahydro-2H-[1,2']bipyridinyl-3-carboxylic acid - Names and Identifiers
| Name | 3,4,5,6-Tetrahydro-2H-[1,2']bipyridinyl-3-carboxylic acid |
| Synonyms | TIMTEC-BB SBB011141 1-Pyridin-2-ylpiperidine-3-carboxylic acid 1-(2-Pyridinyl)-3-piperidinecarboxylic acid 3-Piperidinecarboxylic acid, 1-(2-pyridinyl)- 3,4,5,6-TETRAHYDRO-2H-[1,2']BIPYRIDINYL-3-CARBOXYLIC ACID 3,4,5,6-Tetrahydro-2H-[1,2']bipyridinyl-3-carboxylic acid |
| CAS | 876718-04-6 |
| InChI | InChI=1S/C11H14N2O2/c14-11(15)9-4-3-7-13(8-9)10-5-1-2-6-12-10/h1-2,5-6,9H,3-4,7-8H2,(H,14,15) |
3,4,5,6-Tetrahydro-2H-[1,2']bipyridinyl-3-carboxylic acid - Physico-chemical Properties
| Molecular Formula | C11H14N2O2 |
| Molar Mass | 206.24 |
| Density | 1.233 g/cm3 |
| Boling Point | 407.9 °C at 760 mmHg |
| Flash Point | 200.5 °C |
| Storage Condition | 2-8°C |
3,4,5,6-Tetrahydro-2H-[1,2']bipyridinyl-3-carboxylic acid - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Hazard Class | IRRITANT |
3,4,5,6-Tetrahydro-2H-[1,2']bipyridinyl-3-carboxylic acid - Introduction
3,4,5,6-Tetrahydro-2H-[1,2 ']bipyridinyl-3-carboxylic acid is an organic compound with the chemical formula C12H16N2O2. It has the following properties:
Nature:
-Appearance: White crystalline solid
-Solubility: Soluble in common organic solvents such as ethanol and dichloromethane
-Melting point: about 150-152°C
Use:
-As an intermediate in organic synthesis, it can be used to synthesize drugs and other compounds
-Catalysts that can be used in coordination chemistry and catalytic reactions
Preparation Method:
The preparation method of 3,4,5,6-Tetrahydro-2H-[1,2 ']bipyridinyl-3-carboxylic acid can be carried out by the following steps:
1. to nitrosobenzoic acid salt as raw material, under alkaline conditions with acetylene reaction, the generation of 2-amino phenyl acetylene acid salt.
2. 2-Aminophenylacetylethynate is reacted with p-formaldehyde, and 4-aminobutanol compound is obtained by alcoholation reaction against a pyridine bicyclic ring.
3. Finally, the 4-aminobutanol compound is subjected to an acylation reaction under appropriate reaction conditions to form the final product 3,4,5,6-Tetrahydro-2H-[1,2 ']bipyridinyl-3-carboxylic acid.
Safety Information: The specific safety and toxicity of
3,4,5,6-Tetrahydro-2H-[1,2 ']bipyridinyl-3-carboxylic acid requires further testing and evaluation. Appropriate safety measures, such as wearing gloves, protective glasses and protective clothing, are required when handling the compound. In case of contact with skin or eyes, rinse immediately with plenty of water and seek medical help. At the same time, the compound should be stored in a dry, cool place, and away from fire and oxidizing agents. Observe local safety regulations and proper operating procedures when using and disposing of the compound.
Nature:
-Appearance: White crystalline solid
-Solubility: Soluble in common organic solvents such as ethanol and dichloromethane
-Melting point: about 150-152°C
Use:
-As an intermediate in organic synthesis, it can be used to synthesize drugs and other compounds
-Catalysts that can be used in coordination chemistry and catalytic reactions
Preparation Method:
The preparation method of 3,4,5,6-Tetrahydro-2H-[1,2 ']bipyridinyl-3-carboxylic acid can be carried out by the following steps:
1. to nitrosobenzoic acid salt as raw material, under alkaline conditions with acetylene reaction, the generation of 2-amino phenyl acetylene acid salt.
2. 2-Aminophenylacetylethynate is reacted with p-formaldehyde, and 4-aminobutanol compound is obtained by alcoholation reaction against a pyridine bicyclic ring.
3. Finally, the 4-aminobutanol compound is subjected to an acylation reaction under appropriate reaction conditions to form the final product 3,4,5,6-Tetrahydro-2H-[1,2 ']bipyridinyl-3-carboxylic acid.
Safety Information: The specific safety and toxicity of
3,4,5,6-Tetrahydro-2H-[1,2 ']bipyridinyl-3-carboxylic acid requires further testing and evaluation. Appropriate safety measures, such as wearing gloves, protective glasses and protective clothing, are required when handling the compound. In case of contact with skin or eyes, rinse immediately with plenty of water and seek medical help. At the same time, the compound should be stored in a dry, cool place, and away from fire and oxidizing agents. Observe local safety regulations and proper operating procedures when using and disposing of the compound.
Last Update：2024-04-09 21:11:58
![3,4,5,6-Tetrahydro-2H-[1,2']bipyridinyl-3-carboxylic acid](http://res.chembk.com/assets/str/2d/8/87/876718-04-6.png)
Supplier List
Product Name: 3,4,5,6-TETRAHYDRO-2H-[1,2']BIPYRIDINYL-3-CARBOXYLIC ACID Visit Supplier Webpage Request for quotation
CAS: 876718-04-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 876718-04-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 3,4,5,6-TETRAHYDRO-2H-[1,2']BIPYRIDINYL-3-CARBOXYLIC ACID Visit Supplier Webpage Request for quotation
CAS: 876718-04-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 876718-04-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History